About N-(2-chloro-4,6-dimethylphenyl)-6-fluoro-2-methylquinoline-4-carboxamide
N-(2-chloro-4,6-dimethylphenyl)-6-fluoro-2-methylquinoline-4-carboxamide (PubChem CID 108789682) has the molecular formula C19H16ClFN2O
and a molecular weight of 342.80 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-6-fluoro-2-methylquinoline-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-6-fluoro-2-methylquinoline-4-carboxamide |
| PubChem CID | 108789682 |
| Molecular Formula | C19H16ClFN2O |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-6-fluoro-2-methylquinoline-4-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2cc(C)nc3ccc(F)cc23)c(Cl)c1 |
| InChI | InChI=1S/C19H16ClFN2O/c1-10-6-11(2)18(16(20)7-10)23-19(24)15-8-12(3)22-17-5-4-13(21)9-14(15)17/h4-9H,1-3H3,(H,23,24) |
| InChIKey | LKWUOOZVQLNPEK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-chloro-4,6-dimethylphenyl)-6-fluoro-2-methylquinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-4,6-dimethylphenyl)-6-fluoro-2-methylquinoline-4-carboxamide?
The IUPAC name of N-(2-chloro-4,6-dimethylphenyl)-6-fluoro-2-methylquinoline-4-carboxamide (CID 108789682) is N-(2-chloro-4,6-dimethylphenyl)-6-fluoro-2-methylquinoline-4-carboxamide.
What is the SMILES notation for N-(2-chloro-4,6-dimethylphenyl)-6-fluoro-2-methylquinoline-4-carboxamide?
The canonical SMILES for N-(2-chloro-4,6-dimethylphenyl)-6-fluoro-2-methylquinoline-4-carboxamide is Cc1cc(C)c(NC(=O)c2cc(C)nc3ccc(F)cc23)c(Cl)c1.
What is the InChIKey of N-(2-chloro-4,6-dimethylphenyl)-6-fluoro-2-methylquinoline-4-carboxamide?
The InChIKey is LKWUOOZVQLNPEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClFN2O/c1-10-6-11(2)18(16(20)7-10)23-19(24)15-8-12(3)22-17-5-4-13(21)9-14(15)17/h4-9H,1-3H3,(H,23,24).
What are the key properties of N-(2-chloro-4,6-dimethylphenyl)-6-fluoro-2-methylquinoline-4-carboxamide?
N-(2-chloro-4,6-dimethylphenyl)-6-fluoro-2-methylquinoline-4-carboxamide has a molecular weight of 342.80 g/mol, XLogP of 5.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-4,6-dimethylphenyl)-6-fluoro-2-methylquinoline-4-carboxamide is sourced from PubChem (CID 108789682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).