C16H15FN2O5 — CID 108789630
2-[(6-fluoro-2-methylquinoline-4-carbonyl)amino]pentanedioic acid (PubChem CID 108789630) has the molecular formula C16H15FN2O5 and a molecular weight of 334.30 g/mol. Its IUPAC name is 2-[(6-fluoro-2-methylquinoline-4-carbonyl)amino]pentanedioic acid.
| Compound Name | 2-[(6-fluoro-2-methylquinoline-4-carbonyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 108789630 |
| Molecular Formula | C16H15FN2O5 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-[(6-fluoro-2-methylquinoline-4-carbonyl)amino]pentanedioic acid |
| SMILES | Cc1cc(C(=O)NC(CCC(=O)O)C(=O)O)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C16H15FN2O5/c1-8-6-11(10-7-9(17)2-3-12(10)18-8)15(22)19-13(16(23)24)4-5-14(20)21/h2-3,6-7,13H,4-5H2,1H3,(H,19,22)(H,20,21)(H,23,24) |
| InChIKey | HRZZGSUMHJNNDN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |