C21H18FN3O4 — CID 108802578
3-[[4-[(6-fluoro-2-methylquinoline-4-carbonyl)amino]benzoyl]amino]propanoic acid (PubChem CID 108802578) has the molecular formula C21H18FN3O4 and a molecular weight of 395.39 g/mol. Its IUPAC name is 3-[[4-[(6-fluoro-2-methylquinoline-4-carbonyl)amino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(6-fluoro-2-methylquinoline-4-carbonyl)amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 108802578 |
| Molecular Formula | C21H18FN3O4 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 3-[[4-[(6-fluoro-2-methylquinoline-4-carbonyl)amino]benzoyl]amino]propanoic acid |
| SMILES | Cc1cc(C(=O)Nc2ccc(C(=O)NCCC(=O)O)cc2)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C21H18FN3O4/c1-12-10-17(16-11-14(22)4-7-18(16)24-12)21(29)25-15-5-2-13(3-6-15)20(28)23-9-8-19(26)27/h2-7,10-11H,8-9H2,1H3,(H,23,28)(H,25,29)(H,26,27) |
| InChIKey | HTHFFUZSBOJNRM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |