C20H28FN3O — CID 42750300
N-[5-(diethylamino)pentan-2-yl]-6-fluoro-2-methylquinoline-4-carboxamide (PubChem CID 42750300) has the molecular formula C20H28FN3O and a molecular weight of 345.46 g/mol. Its IUPAC name is N-[5-(diethylamino)pentan-2-yl]-6-fluoro-2-methylquinoline-4-carboxamide.
| Compound Name | N-[5-(diethylamino)pentan-2-yl]-6-fluoro-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 42750300 |
| Molecular Formula | C20H28FN3O |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | N-[5-(diethylamino)pentan-2-yl]-6-fluoro-2-methylquinoline-4-carboxamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)c1cc(C)nc2ccc(F)cc12 |
| InChI | InChI=1S/C20H28FN3O/c1-5-24(6-2)11-7-8-14(3)23-20(25)18-12-15(4)22-19-10-9-16(21)13-17(18)19/h9-10,12-14H,5-8,11H2,1-4H3,(H,23,25) |
| InChIKey | ZYSKQRBYWCSDAU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |