C24H31FN4O — CID 3959644
N-[5-(diethylamino)pentan-2-yl]-6-fluoro-2-(1-methylpyrrol-2-yl)quinoline-4-carboxamide (PubChem CID 3959644) has the molecular formula C24H31FN4O and a molecular weight of 410.54 g/mol. Its IUPAC name is N-[5-(diethylamino)pentan-2-yl]-6-fluoro-2-(1-methylpyrrol-2-yl)quinoline-4-carboxamide.
| Compound Name | N-[5-(diethylamino)pentan-2-yl]-6-fluoro-2-(1-methylpyrrol-2-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3959644 |
| Molecular Formula | C24H31FN4O |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | N-[5-(diethylamino)pentan-2-yl]-6-fluoro-2-(1-methylpyrrol-2-yl)quinoline-4-carboxamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)c1cc(-c2cccn2C)nc2ccc(F)cc12 |
| InChI | InChI=1S/C24H31FN4O/c1-5-29(6-2)14-7-9-17(3)26-24(30)20-16-22(23-10-8-13-28(23)4)27-21-12-11-18(25)15-19(20)21/h8,10-13,15-17H,5-7,9,14H2,1-4H3,(H,26,30) |
| InChIKey | AOVSOEIKSZANAN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |