C19H26FN3O2 — CID 67124691
5-(diethylamino)pentan-2-yl-(7-fluoroquinolin-4-yl)carbamic acid (PubChem CID 67124691) has the molecular formula C19H26FN3O2 and a molecular weight of 347.43 g/mol. Its IUPAC name is 5-(diethylamino)pentan-2-yl-(7-fluoroquinolin-4-yl)carbamic acid.
| Compound Name | 5-(diethylamino)pentan-2-yl-(7-fluoroquinolin-4-yl)carbamic acid |
|---|---|
| PubChem CID | 67124691 |
| Molecular Formula | C19H26FN3O2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 5-(diethylamino)pentan-2-yl-(7-fluoroquinolin-4-yl)carbamic acid |
| SMILES | CCN(CC)CCCC(C)N(C(=O)O)c1ccnc2cc(F)ccc12 |
| InChI | InChI=1S/C19H26FN3O2/c1-4-22(5-2)12-6-7-14(3)23(19(24)25)18-10-11-21-17-13-15(20)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,24,25) |
| InChIKey | WTXDKFPLMUJKQP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |