C26H41ClN4O9P2 — CID 129120630
[3-[4-[(7-chloroquinolin-4-yl)-[5-(diethylamino)pentan-2-yl]carbamoyl]oxybutanoylamino]-1-phosphonopropyl]phosphonic acid (PubChem CID 129120630) has the molecular formula C26H41ClN4O9P2 and a molecular weight of 651.03 g/mol. Its IUPAC name is [3-[4-[(7-chloroquinolin-4-yl)-[5-(diethylamino)pentan-2-yl]carbamoyl]oxybutanoylamino]-1-phosphonopropyl]phosphonic acid.
| Compound Name | [3-[4-[(7-chloroquinolin-4-yl)-[5-(diethylamino)pentan-2-yl]carbamoyl]oxybutanoylamino]-1-phosphonopropyl]phosphonic acid |
|---|---|
| PubChem CID | 129120630 |
| Molecular Formula | C26H41ClN4O9P2 |
| Molecular Weight | 651.03 g/mol |
| Exact Mass | 650.20 |
| IUPAC Name | [3-[4-[(7-chloroquinolin-4-yl)-[5-(diethylamino)pentan-2-yl]carbamoyl]oxybutanoylamino]-1-phosphonopropyl]phosphonic acid |
| SMILES | CCN(CC)CCCC(C)N(C(=O)OCCCC(=O)NCCC(P(=O)(O)O)P(=O)(O)O)c1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C26H41ClN4O9P2/c1-4-30(5-2)16-6-8-19(3)31(23-12-14-28-22-18-20(27)10-11-21(22)23)26(33)40-17-7-9-24(32)29-15-13-25(41(34,35)36)42(37,38)39/h10-12,14,18-19,25H,4-9,13,15-17H2,1-3H3,(H,29,32)(H2,34,35,36)(H2,37,38,39) |
| InChIKey | NSRQGZWLABJVTM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 189.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.03 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|