C24H37BrN4O9P2 — CID 129120640
[[4-[(7-bromoquinolin-4-yl)-[5-(diethylamino)pentan-2-yl]carbamoyl]oxybutanoylamino]-phosphonomethyl]phosphonic acid (PubChem CID 129120640) has the molecular formula C24H37BrN4O9P2 and a molecular weight of 667.43 g/mol. Its IUPAC name is [[4-[(7-bromoquinolin-4-yl)-[5-(diethylamino)pentan-2-yl]carbamoyl]oxybutanoylamino]-phosphonomethyl]phosphonic acid.
| Compound Name | [[4-[(7-bromoquinolin-4-yl)-[5-(diethylamino)pentan-2-yl]carbamoyl]oxybutanoylamino]-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 129120640 |
| Molecular Formula | C24H37BrN4O9P2 |
| Molecular Weight | 667.43 g/mol |
| Exact Mass | 666.12 |
| IUPAC Name | [[4-[(7-bromoquinolin-4-yl)-[5-(diethylamino)pentan-2-yl]carbamoyl]oxybutanoylamino]-phosphonomethyl]phosphonic acid |
| SMILES | CCN(CC)CCCC(C)N(C(=O)OCCCC(=O)NC(P(=O)(O)O)P(=O)(O)O)c1ccnc2cc(Br)ccc12 |
| InChI | InChI=1S/C24H37BrN4O9P2/c1-4-28(5-2)14-6-8-17(3)29(21-12-13-26-20-16-18(25)10-11-19(20)21)24(31)38-15-7-9-22(30)27-23(39(32,33)34)40(35,36)37/h10-13,16-17,23H,4-9,14-15H2,1-3H3,(H,27,30)(H2,32,33,34)(H2,35,36,37) |
| InChIKey | CIJANBUFVVDZMC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 189.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|