C28H47ClN4O7P2 — CID 145307359
[3-[4-[(7-chloroquinolin-4-yl)-[5-(diethylamino)pentan-2-yl]carbamoyl]oxybutanoylamino]-1-hydroxyphosphanylpropyl]phosphonic acid;ethane (PubChem CID 145307359) has the molecular formula C28H47ClN4O7P2 and a molecular weight of 649.11 g/mol. Its IUPAC name is [3-[4-[(7-chloroquinolin-4-yl)-[5-(diethylamino)pentan-2-yl]carbamoyl]oxybutanoylamino]-1-hydroxyphosphanylpropyl]phosphonic acid;ethane.
| Compound Name | [3-[4-[(7-chloroquinolin-4-yl)-[5-(diethylamino)pentan-2-yl]carbamoyl]oxybutanoylamino]-1-hydroxyphosphanylpropyl]phosphonic acid;ethane |
|---|---|
| PubChem CID | 145307359 |
| Molecular Formula | C28H47ClN4O7P2 |
| Molecular Weight | 649.11 g/mol |
| Exact Mass | 648.26 |
| IUPAC Name | [3-[4-[(7-chloroquinolin-4-yl)-[5-(diethylamino)pentan-2-yl]carbamoyl]oxybutanoylamino]-1-hydroxyphosphanylpropyl]phosphonic acid;ethane |
| SMILES | CC.CCN(CC)CCCC(C)N(C(=O)OCCCC(=O)NCCC(PO)P(=O)(O)O)c1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C26H41ClN4O7P2.C2H6/c1-4-30(5-2)16-6-8-19(3)31(23-12-14-28-22-18-20(27)10-11-21(22)23)26(33)38-17-7-9-24(32)29-15-13-25(39-34)40(35,36)37;1-2/h10-12,14,18-19,25,34,39H,4-9,13,15-17H2,1-3H3,(H,29,32)(H2,35,36,37);1-2H3 |
| InChIKey | UIWXSPFIYFJBKB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 152.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.11 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|