C21H32ClN3O8P2 — CID 129120656
[1-[(7-chloroquinolin-4-yl)-[5-(diethylamino)pentan-2-yl]carbamoyl]oxy-1-phosphonoethyl]phosphonic acid (PubChem CID 129120656) has the molecular formula C21H32ClN3O8P2 and a molecular weight of 551.90 g/mol. Its IUPAC name is [1-[(7-chloroquinolin-4-yl)-[5-(diethylamino)pentan-2-yl]carbamoyl]oxy-1-phosphonoethyl]phosphonic acid.
| Compound Name | [1-[(7-chloroquinolin-4-yl)-[5-(diethylamino)pentan-2-yl]carbamoyl]oxy-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 129120656 |
| Molecular Formula | C21H32ClN3O8P2 |
| Molecular Weight | 551.90 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | [1-[(7-chloroquinolin-4-yl)-[5-(diethylamino)pentan-2-yl]carbamoyl]oxy-1-phosphonoethyl]phosphonic acid |
| SMILES | CCN(CC)CCCC(C)N(C(=O)OC(C)(P(=O)(O)O)P(=O)(O)O)c1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C21H32ClN3O8P2/c1-5-24(6-2)13-7-8-15(3)25(19-11-12-23-18-14-16(22)9-10-17(18)19)20(26)33-21(4,34(27,28)29)35(30,31)32/h9-12,14-15H,5-8,13H2,1-4H3,(H2,27,28,29)(H2,30,31,32) |
| InChIKey | MVHQQRNMAQIGDH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 160.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.90 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|