C25H41ClN4O8P2 — CID 145307328
[dihydroxyphosphanyl(methylamino)methyl]phosphonic acid;4-oxobutyl N-(7-chloroquinolin-4-yl)-N-[5-(diethylamino)pentan-2-yl]carbamate (PubChem CID 145307328) has the molecular formula C25H41ClN4O8P2 and a molecular weight of 623.02 g/mol. Its IUPAC name is [dihydroxyphosphanyl(methylamino)methyl]phosphonic acid;4-oxobutyl N-(7-chloroquinolin-4-yl)-N-[5-(diethylamino)pentan-2-yl]carbamate.
| Compound Name | [dihydroxyphosphanyl(methylamino)methyl]phosphonic acid;4-oxobutyl N-(7-chloroquinolin-4-yl)-N-[5-(diethylamino)pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 145307328 |
| Molecular Formula | C25H41ClN4O8P2 |
| Molecular Weight | 623.02 g/mol |
| Exact Mass | 622.21 |
| IUPAC Name | [dihydroxyphosphanyl(methylamino)methyl]phosphonic acid;4-oxobutyl N-(7-chloroquinolin-4-yl)-N-[5-(diethylamino)pentan-2-yl]carbamate |
| SMILES | CCN(CC)CCCC(C)N(C(=O)OCCCC=O)c1ccnc2cc(Cl)ccc12.CNC(P(O)O)P(=O)(O)O |
| InChI | InChI=1S/C23H32ClN3O3.C2H9NO5P2/c1-4-26(5-2)14-8-9-18(3)27(23(29)30-16-7-6-15-28)22-12-13-25-21-17-19(24)10-11-20(21)22;1-3-2(9(4)5)10(6,7)8/h10-13,15,17-18H,4-9,14,16H2,1-3H3;2-5H,1H3,(H2,6,7,8) |
| InChIKey | MIANMZXLRKBOBZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 172.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.02 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|