C22H31ClN4O2S — CID 145307316
S-(3-nitrosopropyl) N-(7-chloroquinolin-4-yl)-N-[5-(diethylamino)pentan-2-yl]carbamothioate (PubChem CID 145307316) has the molecular formula C22H31ClN4O2S and a molecular weight of 451.04 g/mol. Its IUPAC name is S-(3-nitrosopropyl) N-(7-chloroquinolin-4-yl)-N-[5-(diethylamino)pentan-2-yl]carbamothioate.
| Compound Name | S-(3-nitrosopropyl) N-(7-chloroquinolin-4-yl)-N-[5-(diethylamino)pentan-2-yl]carbamothioate |
|---|---|
| PubChem CID | 145307316 |
| Molecular Formula | C22H31ClN4O2S |
| Molecular Weight | 451.04 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | S-(3-nitrosopropyl) N-(7-chloroquinolin-4-yl)-N-[5-(diethylamino)pentan-2-yl]carbamothioate |
| SMILES | CCN(CC)CCCC(C)N(C(=O)SCCCN=O)c1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C22H31ClN4O2S/c1-4-26(5-2)14-6-8-17(3)27(22(28)30-15-7-12-25-29)21-11-13-24-20-16-18(23)9-10-19(20)21/h9-11,13,16-17H,4-8,12,14-15H2,1-3H3 |
| InChIKey | UTHFOOWVPDVEFG-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 65.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.04 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|