C22H23NO4 — CID 3384731
6-butan-2-yl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxylic acid (PubChem CID 3384731) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 6-butan-2-yl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxylic acid.
| Compound Name | 6-butan-2-yl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3384731 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 6-butan-2-yl-2-(3,4-dimethoxyphenyl)quinoline-4-carboxylic acid |
| SMILES | CCC(C)c1ccc2nc(-c3ccc(OC)c(OC)c3)cc(C(=O)O)c2c1 |
| InChI | InChI=1S/C22H23NO4/c1-5-13(2)14-6-8-18-16(10-14)17(22(24)25)12-19(23-18)15-7-9-20(26-3)21(11-15)27-4/h6-13H,5H2,1-4H3,(H,24,25) |
| InChIKey | DNKDLJANMYEYGQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |