C29H30N2O5S — CID 58362448
2-[N-[(2-methylpropan-2-yl)oxycarbonyl]-4-quinolin-2-ylanilino]ethyl 4-methylbenzenesulfonate (PubChem CID 58362448) has the molecular formula C29H30N2O5S and a molecular weight of 518.64 g/mol. Its IUPAC name is 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]-4-quinolin-2-ylanilino]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]-4-quinolin-2-ylanilino]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58362448 |
| Molecular Formula | C29H30N2O5S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]-4-quinolin-2-ylanilino]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCN(C(=O)OC(C)(C)C)c2ccc(-c3ccc4ccccc4n3)cc2)cc1 |
| InChI | InChI=1S/C29H30N2O5S/c1-21-9-16-25(17-10-21)37(33,34)35-20-19-31(28(32)36-29(2,3)4)24-14-11-23(12-15-24)27-18-13-22-7-5-6-8-26(22)30-27/h5-18H,19-20H2,1-4H3 |
| InChIKey | AUBKLJLTODTLBM-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|