C28H31N3O5S — CID 58362672
2-[2-[2-[methyl-(5-quinolin-2-yl-2-pyridinyl)amino]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 58362672) has the molecular formula C28H31N3O5S and a molecular weight of 521.64 g/mol. Its IUPAC name is 2-[2-[2-[methyl-(5-quinolin-2-yl-2-pyridinyl)amino]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[2-[methyl-(5-quinolin-2-yl-2-pyridinyl)amino]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58362672 |
| Molecular Formula | C28H31N3O5S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 2-[2-[2-[methyl-(5-quinolin-2-yl-2-pyridinyl)amino]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCN(C)c2ccc(-c3ccc4ccccc4n3)cn2)cc1 |
| InChI | InChI=1S/C28H31N3O5S/c1-22-7-11-25(12-8-22)37(32,33)36-20-19-35-18-17-34-16-15-31(2)28-14-10-24(21-29-28)27-13-9-23-5-3-4-6-26(23)30-27/h3-14,21H,15-20H2,1-2H3 |
| InChIKey | AKISJTXGORAMDC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|