C32H44N2O5 — CID 118657084
tert-butyl N-[4-[7-(1,3-dibutoxypropan-2-yloxy)quinolin-2-yl]phenyl]-N-methylcarbamate (PubChem CID 118657084) has the molecular formula C32H44N2O5 and a molecular weight of 536.71 g/mol. Its IUPAC name is tert-butyl N-[4-[7-(1,3-dibutoxypropan-2-yloxy)quinolin-2-yl]phenyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[7-(1,3-dibutoxypropan-2-yloxy)quinolin-2-yl]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 118657084 |
| Molecular Formula | C32H44N2O5 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | tert-butyl N-[4-[7-(1,3-dibutoxypropan-2-yloxy)quinolin-2-yl]phenyl]-N-methylcarbamate |
| SMILES | CCCCOCC(COCCCC)Oc1ccc2ccc(-c3ccc(N(C)C(=O)OC(C)(C)C)cc3)nc2c1 |
| InChI | InChI=1S/C32H44N2O5/c1-7-9-19-36-22-28(23-37-20-10-8-2)38-27-17-13-25-14-18-29(33-30(25)21-27)24-11-15-26(16-12-24)34(6)31(35)39-32(3,4)5/h11-18,21,28H,7-10,19-20,22-23H2,1-6H3 |
| InChIKey | VZLGWIDJPDDWPC-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|