C19H20N2O — CID 125465220
4-(6-ethoxyquinolin-2-yl)-N,N-dimethylaniline (PubChem CID 125465220) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-(6-ethoxyquinolin-2-yl)-N,N-dimethylaniline.
| Compound Name | 4-(6-ethoxyquinolin-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 125465220 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 4-(6-ethoxyquinolin-2-yl)-N,N-dimethylaniline |
| SMILES | CCOc1ccc2nc(-c3ccc(N(C)C)cc3)ccc2c1 |
| InChI | InChI=1S/C19H20N2O/c1-4-22-17-10-12-19-15(13-17)7-11-18(20-19)14-5-8-16(9-6-14)21(2)3/h5-13H,4H2,1-3H3 |
| InChIKey | RXNVRSZKOQJOAN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |