C10H15NO — CID 3624890
4-ethoxy-N,N-dimethylaniline (PubChem CID 3624890) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-ethoxy-N,N-dimethylaniline.
| Compound Name | 4-ethoxy-N,N-dimethylaniline |
|---|---|
| PubChem CID | 3624890 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 4-ethoxy-N,N-dimethylaniline |
| SMILES | CCOc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C10H15NO/c1-4-12-10-7-5-9(6-8-10)11(2)3/h5-8H,4H2,1-3H3 |
| InChIKey | NOTZHLDTUSLGBM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|