C21H32Cl2N2O2 — CID 135564251
4-[5-[4-(dimethylamino)phenoxy]pentoxy]-N,N-dimethylaniline;dihydrochloride (PubChem CID 135564251) has the molecular formula C21H32Cl2N2O2 and a molecular weight of 415.41 g/mol. Its IUPAC name is 4-[5-[4-(dimethylamino)phenoxy]pentoxy]-N,N-dimethylaniline;dihydrochloride.
| Compound Name | 4-[5-[4-(dimethylamino)phenoxy]pentoxy]-N,N-dimethylaniline;dihydrochloride |
|---|---|
| PubChem CID | 135564251 |
| Molecular Formula | C21H32Cl2N2O2 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-[5-[4-(dimethylamino)phenoxy]pentoxy]-N,N-dimethylaniline;dihydrochloride |
| SMILES | CN(C)c1ccc(OCCCCCOc2ccc(N(C)C)cc2)cc1.Cl.Cl |
| InChI | InChI=1S/C21H30N2O2.2ClH/c1-22(2)18-8-12-20(13-9-18)24-16-6-5-7-17-25-21-14-10-19(11-15-21)23(3)4;;/h8-15H,5-7,16-17H2,1-4H3;2*1H |
| InChIKey | ARWIFWBKZPGHCJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|