C18H20NO2Si — CID 154595634
CID 154595634 (PubChem CID 154595634) has the molecular formula C18H20NO2Si and a molecular weight of 310.45 g/mol.
| Compound Name | CID 154595634 |
|---|---|
| PubChem CID | 154595634 |
| Molecular Formula | C18H20NO2Si |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccc(C(=O)c2ccc(OCCC[Si])cc2)cc1 |
| InChI | InChI=1S/C18H20NO2Si/c1-19(2)16-8-4-14(5-9-16)18(20)15-6-10-17(11-7-15)21-12-3-13-22/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | GSCFZXKHWDINFR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|