C25H30N2O — CID 6300604
4-[(E)-2-(6-ethoxyquinolin-2-yl)ethenyl]-N,N-dipropylaniline (PubChem CID 6300604) has the molecular formula C25H30N2O and a molecular weight of 374.53 g/mol. Its IUPAC name is 4-[(E)-2-(6-ethoxyquinolin-2-yl)ethenyl]-N,N-dipropylaniline.
| Compound Name | 4-[(E)-2-(6-ethoxyquinolin-2-yl)ethenyl]-N,N-dipropylaniline |
|---|---|
| PubChem CID | 6300604 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 4-[(E)-2-(6-ethoxyquinolin-2-yl)ethenyl]-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1ccc(/C=C/c2ccc3cc(OCC)ccc3n2)cc1 |
| InChI | InChI=1S/C25H30N2O/c1-4-17-27(18-5-2)23-13-8-20(9-14-23)7-11-22-12-10-21-19-24(28-6-3)15-16-25(21)26-22/h7-16,19H,4-6,17-18H2,1-3H3/b11-7+ |
| InChIKey | BAXMFOTYCJGOCE-YRNVUSSQSA-N |
| XLogP | 6.43 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|