C22H25N2O+ — CID 4088723
4-[2-(6-ethoxy-1-methylquinolin-1-ium-2-yl)ethenyl]-N,N-dimethylaniline (PubChem CID 4088723) has the molecular formula C22H25N2O+ and a molecular weight of 333.46 g/mol. Its IUPAC name is 4-[2-(6-ethoxy-1-methylquinolin-1-ium-2-yl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-(6-ethoxy-1-methylquinolin-1-ium-2-yl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 4088723 |
| Molecular Formula | C22H25N2O+ |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 4-[2-(6-ethoxy-1-methylquinolin-1-ium-2-yl)ethenyl]-N,N-dimethylaniline |
| SMILES | CCOc1ccc2c(ccc(C=Cc3ccc(N(C)C)cc3)[n+]2C)c1 |
| InChI | InChI=1S/C22H25N2O/c1-5-25-21-14-15-22-18(16-21)9-13-20(24(22)4)12-8-17-6-10-19(11-7-17)23(2)3/h6-16H,5H2,1-4H3/q+1 |
| InChIKey | XPFROOKILKGYBH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|