C21H23N2O+ — CID 74830862
4-[2-(6-methoxy-1-methylquinolin-1-ium-2-yl)ethenyl]-N,N-dimethylaniline (PubChem CID 74830862) has the molecular formula C21H23N2O+ and a molecular weight of 319.43 g/mol. Its IUPAC name is 4-[2-(6-methoxy-1-methylquinolin-1-ium-2-yl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-(6-methoxy-1-methylquinolin-1-ium-2-yl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 74830862 |
| Molecular Formula | C21H23N2O+ |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 4-[2-(6-methoxy-1-methylquinolin-1-ium-2-yl)ethenyl]-N,N-dimethylaniline |
| SMILES | COc1ccc2c(ccc(C=Cc3ccc(N(C)C)cc3)[n+]2C)c1 |
| InChI | InChI=1S/C21H23N2O/c1-22(2)18-9-5-16(6-10-18)7-11-19-12-8-17-15-20(24-4)13-14-21(17)23(19)3/h5-15H,1-4H3/q+1 |
| InChIKey | AJOBSGHWPQLAPI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|