C13H15NO — CID 117043645
6-methoxy-N,N-dimethylnaphthalen-2-amine (PubChem CID 117043645) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 6-methoxy-N,N-dimethylnaphthalen-2-amine.
| Compound Name | 6-methoxy-N,N-dimethylnaphthalen-2-amine |
|---|---|
| PubChem CID | 117043645 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 6-methoxy-N,N-dimethylnaphthalen-2-amine |
| SMILES | COc1ccc2cc(N(C)C)ccc2c1 |
| InChI | InChI=1S/C13H15NO/c1-14(2)12-6-4-11-9-13(15-3)7-5-10(11)8-12/h4-9H,1-3H3 |
| InChIKey | MYNDOXHBLVSQIP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |