C24H30ClN2O+ — CID 167513378
chloromethane;ethane;2-methoxy-N,N,5-trimethylbenzo[c]phenanthridin-5-ium-9-amine (PubChem CID 167513378) has the molecular formula C24H30ClN2O+ and a molecular weight of 397.97 g/mol. Its IUPAC name is chloromethane;ethane;2-methoxy-N,N,5-trimethylbenzo[c]phenanthridin-5-ium-9-amine.
| Compound Name | chloromethane;ethane;2-methoxy-N,N,5-trimethylbenzo[c]phenanthridin-5-ium-9-amine |
|---|---|
| PubChem CID | 167513378 |
| Molecular Formula | C24H30ClN2O+ |
| Molecular Weight | 397.97 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | chloromethane;ethane;2-methoxy-N,N,5-trimethylbenzo[c]phenanthridin-5-ium-9-amine |
| SMILES | CC.CCl.COc1ccc2c(ccc3c4cc(N(C)C)ccc4c[n+](C)c23)c1 |
| InChI | InChI=1S/C21H21N2O.C2H6.CH3Cl/c1-22(2)16-7-5-15-13-23(3)21-18-10-8-17(24-4)11-14(18)6-9-19(21)20(15)12-16;2*1-2/h5-13H,1-4H3;1-2H3;1H3/q+1;; |
| InChIKey | MKGCOVKRFPSXIA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.97 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|