C22H24N2O2 — CID 70476118
4-N,4-N-bis(4-methoxyphenyl)-1-N,1-N-dimethylbenzene-1,4-diamine (PubChem CID 70476118) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 4-N,4-N-bis(4-methoxyphenyl)-1-N,1-N-dimethylbenzene-1,4-diamine.
| Compound Name | 4-N,4-N-bis(4-methoxyphenyl)-1-N,1-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 70476118 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 4-N,4-N-bis(4-methoxyphenyl)-1-N,1-N-dimethylbenzene-1,4-diamine |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H24N2O2/c1-23(2)17-5-7-18(8-6-17)24(19-9-13-21(25-3)14-10-19)20-11-15-22(26-4)16-12-20/h5-16H,1-4H3 |
| InChIKey | URZXZXCXQKBCJM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|