C10H16N2O — CID 130402433
1-(4-methoxyphenyl)-1,2,2-trimethylhydrazine (PubChem CID 130402433) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-1,2,2-trimethylhydrazine.
| Compound Name | 1-(4-methoxyphenyl)-1,2,2-trimethylhydrazine |
|---|---|
| PubChem CID | 130402433 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-(4-methoxyphenyl)-1,2,2-trimethylhydrazine |
| SMILES | COc1ccc(N(C)N(C)C)cc1 |
| InChI | InChI=1S/C10H16N2O/c1-11(2)12(3)9-5-7-10(13-4)8-6-9/h5-8H,1-4H3 |
| InChIKey | WRVPDSSPYJQGMR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|