C7H7F3N2O — CID 175078547
1,1,2-trifluoro-2-(4-methoxyphenyl)hydrazine (PubChem CID 175078547) has the molecular formula C7H7F3N2O and a molecular weight of 192.14 g/mol. Its IUPAC name is 1,1,2-trifluoro-2-(4-methoxyphenyl)hydrazine.
| Compound Name | 1,1,2-trifluoro-2-(4-methoxyphenyl)hydrazine |
|---|---|
| PubChem CID | 175078547 |
| Molecular Formula | C7H7F3N2O |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 1,1,2-trifluoro-2-(4-methoxyphenyl)hydrazine |
| SMILES | COc1ccc(N(F)N(F)F)cc1 |
| InChI | InChI=1S/C7H7F3N2O/c1-13-7-4-2-6(3-5-7)11(8)12(9)10/h2-5H,1H3 |
| InChIKey | BDPZLYKRKUWCHR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|