About (4-methoxyphenyl)silane
(4-methoxyphenyl)silane (PubChem CID 100998160) has the molecular formula C7H10OSi
and a molecular weight of 138.24 g/mol. Its IUPAC name is (4-methoxyphenyl)silane.
Molecular Properties
| Compound Name | (4-methoxyphenyl)silane |
| PubChem CID | 100998160 |
| Molecular Formula | C7H10OSi |
| Molecular Weight | 138.24 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | (4-methoxyphenyl)silane |
| SMILES | COc1ccc([SiH3])cc1 |
| InChI | InChI=1S/C7H10OSi/c1-8-6-2-4-7(9)5-3-6/h2-5H,1,9H3 |
| InChIKey | RAEPTYMQPZQCMG-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)silane?
The IUPAC name of (4-methoxyphenyl)silane (CID 100998160) is (4-methoxyphenyl)silane.
What is the SMILES notation for (4-methoxyphenyl)silane?
The canonical SMILES for (4-methoxyphenyl)silane is COc1ccc([SiH3])cc1.
What is the InChIKey of (4-methoxyphenyl)silane?
The InChIKey is RAEPTYMQPZQCMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10OSi/c1-8-6-2-4-7(9)5-3-6/h2-5H,1,9H3.
What are the key properties of (4-methoxyphenyl)silane?
(4-methoxyphenyl)silane has a molecular weight of 138.24 g/mol, XLogP of -0.31, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)silane is sourced from PubChem (CID 100998160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).