C14H17ClN2O2 — CID 20517959
1,1-bis(4-methoxyphenyl)hydrazine;hydrochloride (PubChem CID 20517959) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.76 g/mol. Its IUPAC name is 1,1-bis(4-methoxyphenyl)hydrazine;hydrochloride.
| Compound Name | 1,1-bis(4-methoxyphenyl)hydrazine;hydrochloride |
|---|---|
| PubChem CID | 20517959 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1,1-bis(4-methoxyphenyl)hydrazine;hydrochloride |
| SMILES | COc1ccc(N(N)c2ccc(OC)cc2)cc1.Cl |
| InChI | InChI=1S/C14H16N2O2.ClH/c1-17-13-7-3-11(4-8-13)16(15)12-5-9-14(18-2)10-6-12;/h3-10H,15H2,1-2H3;1H |
| InChIKey | PKCJCNILRDJEOD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|