About CID 12607295
CID 12607295 (PubChem CID 12607295) has the molecular formula C7H7OTe
and a molecular weight of 234.73 g/mol.
Molecular Properties
| Compound Name | CID 12607295 |
| PubChem CID | 12607295 |
| Molecular Formula | C7H7OTe |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 236.96 |
| IUPAC Name | — |
| SMILES | COc1ccc([Te])cc1 |
| InChI | InChI=1S/C7H7OTe/c1-8-6-2-4-7(9)5-3-6/h2-5H,1H3 |
| InChIKey | VYSSJOSJFKXLPU-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 12607295 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12607295?
The IUPAC name of CID 12607295 (CID 12607295) is not available.
What is the SMILES notation for CID 12607295?
The canonical SMILES for CID 12607295 is COc1ccc([Te])cc1.
What is the InChIKey of CID 12607295?
The InChIKey is VYSSJOSJFKXLPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7OTe/c1-8-6-2-4-7(9)5-3-6/h2-5H,1H3.
What are the key properties of CID 12607295?
CID 12607295 has a molecular weight of 234.73 g/mol, XLogP of 0.49, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12607295 is sourced from PubChem (CID 12607295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).