About (4-methoxyanilino) thiohypofluorite
(4-methoxyanilino) thiohypofluorite (PubChem CID 175225532) has the molecular formula C7H8FNOS
and a molecular weight of 173.21 g/mol. Its IUPAC name is (4-methoxyanilino) thiohypofluorite.
Molecular Properties
| Compound Name | (4-methoxyanilino) thiohypofluorite |
| PubChem CID | 175225532 |
| Molecular Formula | C7H8FNOS |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | (4-methoxyanilino) thiohypofluorite |
| SMILES | COc1ccc(NSF)cc1 |
| InChI | InChI=1S/C7H8FNOS/c1-10-7-4-2-6(3-5-7)9-11-8/h2-5,9H,1H3 |
| InChIKey | GOXKCKGHGILBIN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyanilino) thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyanilino) thiohypofluorite?
The IUPAC name of (4-methoxyanilino) thiohypofluorite (CID 175225532) is (4-methoxyanilino) thiohypofluorite.
What is the SMILES notation for (4-methoxyanilino) thiohypofluorite?
The canonical SMILES for (4-methoxyanilino) thiohypofluorite is COc1ccc(NSF)cc1.
What is the InChIKey of (4-methoxyanilino) thiohypofluorite?
The InChIKey is GOXKCKGHGILBIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FNOS/c1-10-7-4-2-6(3-5-7)9-11-8/h2-5,9H,1H3.
What are the key properties of (4-methoxyanilino) thiohypofluorite?
(4-methoxyanilino) thiohypofluorite has a molecular weight of 173.21 g/mol, XLogP of 2.64, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyanilino) thiohypofluorite is sourced from PubChem (CID 175225532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).