C21H20FNO3 — CID 101074590
N-(4-fluorophenyl)-3,5-dimethoxy-N-(4-methoxyphenyl)aniline (PubChem CID 101074590) has the molecular formula C21H20FNO3 and a molecular weight of 353.39 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3,5-dimethoxy-N-(4-methoxyphenyl)aniline.
| Compound Name | N-(4-fluorophenyl)-3,5-dimethoxy-N-(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 101074590 |
| Molecular Formula | C21H20FNO3 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-(4-fluorophenyl)-3,5-dimethoxy-N-(4-methoxyphenyl)aniline |
| SMILES | COc1ccc(N(c2ccc(F)cc2)c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C21H20FNO3/c1-24-19-10-8-17(9-11-19)23(16-6-4-15(22)5-7-16)18-12-20(25-2)14-21(13-18)26-3/h4-14H,1-3H3 |
| InChIKey | SECOSNSZQIGWGE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |