About difluoromethane;1-fluoro-4-methoxybenzene
difluoromethane;1-fluoro-4-methoxybenzene (PubChem CID 157211198) has the molecular formula C8H9F3O
and a molecular weight of 178.15 g/mol. Its IUPAC name is difluoromethane;1-fluoro-4-methoxybenzene.
Molecular Properties
| Compound Name | difluoromethane;1-fluoro-4-methoxybenzene |
| PubChem CID | 157211198 |
| Molecular Formula | C8H9F3O |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | difluoromethane;1-fluoro-4-methoxybenzene |
| SMILES | COc1ccc(F)cc1.FCF |
| InChI | InChI=1S/C7H7FO.CH2F2/c1-9-7-4-2-6(8)3-5-7;2-1-3/h2-5H,1H3;1H2 |
| InChIKey | ARXFIZHTOBFFKF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze difluoromethane;1-fluoro-4-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoromethane;1-fluoro-4-methoxybenzene?
The IUPAC name of difluoromethane;1-fluoro-4-methoxybenzene (CID 157211198) is difluoromethane;1-fluoro-4-methoxybenzene.
What is the SMILES notation for difluoromethane;1-fluoro-4-methoxybenzene?
The canonical SMILES for difluoromethane;1-fluoro-4-methoxybenzene is COc1ccc(F)cc1.FCF.
What is the InChIKey of difluoromethane;1-fluoro-4-methoxybenzene?
The InChIKey is ARXFIZHTOBFFKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FO.CH2F2/c1-9-7-4-2-6(8)3-5-7;2-1-3/h2-5H,1H3;1H2.
What are the key properties of difluoromethane;1-fluoro-4-methoxybenzene?
difluoromethane;1-fluoro-4-methoxybenzene has a molecular weight of 178.15 g/mol, XLogP of 2.72, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for difluoromethane;1-fluoro-4-methoxybenzene is sourced from PubChem (CID 157211198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).