C25H27N3O — CID 100984975
2,2-bis[4-(dimethylamino)phenyl]-2-(4-methoxyphenyl)acetonitrile (PubChem CID 100984975) has the molecular formula C25H27N3O and a molecular weight of 385.51 g/mol. Its IUPAC name is 2,2-bis[4-(dimethylamino)phenyl]-2-(4-methoxyphenyl)acetonitrile.
| Compound Name | 2,2-bis[4-(dimethylamino)phenyl]-2-(4-methoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 100984975 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 2,2-bis[4-(dimethylamino)phenyl]-2-(4-methoxyphenyl)acetonitrile |
| SMILES | COc1ccc(C(C#N)(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H27N3O/c1-27(2)22-12-6-19(7-13-22)25(18-26,21-10-16-24(29-5)17-11-21)20-8-14-23(15-9-20)28(3)4/h6-17H,1-5H3 |
| InChIKey | PCYAWEBLYFTVQI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|