C24H24FN3 — CID 102013870
2,2-bis[4-(dimethylamino)phenyl]-2-(4-fluorophenyl)acetonitrile (PubChem CID 102013870) has the molecular formula C24H24FN3 and a molecular weight of 373.48 g/mol. Its IUPAC name is 2,2-bis[4-(dimethylamino)phenyl]-2-(4-fluorophenyl)acetonitrile.
| Compound Name | 2,2-bis[4-(dimethylamino)phenyl]-2-(4-fluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 102013870 |
| Molecular Formula | C24H24FN3 |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 2,2-bis[4-(dimethylamino)phenyl]-2-(4-fluorophenyl)acetonitrile |
| SMILES | CN(C)c1ccc(C(C#N)(c2ccc(F)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H24FN3/c1-27(2)22-13-7-19(8-14-22)24(17-26,18-5-11-21(25)12-6-18)20-9-15-23(16-10-20)28(3)4/h5-16H,1-4H3 |
| InChIKey | SVWOFELZZADPDA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|