C32H39N3O4 — CID 15883913
2-[4-(dimethylamino)phenyl]-2-phenyl-2-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]acetonitrile (PubChem CID 15883913) has the molecular formula C32H39N3O4 and a molecular weight of 529.68 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-2-phenyl-2-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]acetonitrile.
| Compound Name | 2-[4-(dimethylamino)phenyl]-2-phenyl-2-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 15883913 |
| Molecular Formula | C32H39N3O4 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-2-phenyl-2-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]acetonitrile |
| SMILES | CN(C)c1ccc(C(C#N)(c2ccccc2)c2ccc(N3CCOCCOCCOCCOCC3)cc2)cc1 |
| InChI | InChI=1S/C32H39N3O4/c1-34(2)30-12-8-28(9-13-30)32(26-33,27-6-4-3-5-7-27)29-10-14-31(15-11-29)35-16-18-36-20-22-38-24-25-39-23-21-37-19-17-35/h3-15H,16-25H2,1-2H3 |
| InChIKey | QVEVCVCDCYQTHY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 67.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|