C25H37N3O4 — CID 101022137
1-N,1-N,4-N-trimethyl-4-N-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]benzene-1,4-diamine (PubChem CID 101022137) has the molecular formula C25H37N3O4 and a molecular weight of 443.59 g/mol. Its IUPAC name is 1-N,1-N,4-N-trimethyl-4-N-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]benzene-1,4-diamine.
| Compound Name | 1-N,1-N,4-N-trimethyl-4-N-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 101022137 |
| Molecular Formula | C25H37N3O4 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 1-N,1-N,4-N-trimethyl-4-N-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]benzene-1,4-diamine |
| SMILES | CN(C)c1ccc(N(C)c2ccc(N3CCOCCOCCOCCOCC3)cc2)cc1 |
| InChI | InChI=1S/C25H37N3O4/c1-26(2)22-4-6-23(7-5-22)27(3)24-8-10-25(11-9-24)28-12-14-29-16-18-31-20-21-32-19-17-30-15-13-28/h4-11H,12-21H2,1-3H3 |
| InChIKey | QDXQGLFZPRHKMV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 46.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|