C12H19N3 — CID 4738754
N,N-dimethyl-4-piperazin-1-ylaniline (PubChem CID 4738754) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is N,N-dimethyl-4-piperazin-1-ylaniline.
| Compound Name | N,N-dimethyl-4-piperazin-1-ylaniline |
|---|---|
| PubChem CID | 4738754 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N,N-dimethyl-4-piperazin-1-ylaniline |
| SMILES | CN(C)c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C12H19N3/c1-14(2)11-3-5-12(6-4-11)15-9-7-13-8-10-15/h3-6,13H,7-10H2,1-2H3 |
| InChIKey | GRJIAPLFQXLDJJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|