C16H23ClN4O2 — CID 170749335
3-(N-methyl-4-piperazin-1-ylanilino)piperidine-2,6-dione;hydrochloride (PubChem CID 170749335) has the molecular formula C16H23ClN4O2 and a molecular weight of 338.84 g/mol. Its IUPAC name is 3-(N-methyl-4-piperazin-1-ylanilino)piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-(N-methyl-4-piperazin-1-ylanilino)piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 170749335 |
| Molecular Formula | C16H23ClN4O2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 3-(N-methyl-4-piperazin-1-ylanilino)piperidine-2,6-dione;hydrochloride |
| SMILES | CN(c1ccc(N2CCNCC2)cc1)C1CCC(=O)NC1=O.Cl |
| InChI | InChI=1S/C16H22N4O2.ClH/c1-19(14-6-7-15(21)18-16(14)22)12-2-4-13(5-3-12)20-10-8-17-9-11-20;/h2-5,14,17H,6-11H2,1H3,(H,18,21,22);1H |
| InChIKey | RISOFAYHYJKAJV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|