C17H23N5O3 — CID 168992484
N-(2,6-dioxopiperidin-3-yl)-N-[(3-methyl-6-piperazin-1-yl-2-pyridinyl)methyl]formamide (PubChem CID 168992484) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-N-[(3-methyl-6-piperazin-1-yl-2-pyridinyl)methyl]formamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-N-[(3-methyl-6-piperazin-1-yl-2-pyridinyl)methyl]formamide |
|---|---|
| PubChem CID | 168992484 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-N-[(3-methyl-6-piperazin-1-yl-2-pyridinyl)methyl]formamide |
| SMILES | Cc1ccc(N2CCNCC2)nc1CN(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C17H23N5O3/c1-12-2-4-15(21-8-6-18-7-9-21)19-13(12)10-22(11-23)14-3-5-16(24)20-17(14)25/h2,4,11,14,18H,3,5-10H2,1H3,(H,20,24,25) |
| InChIKey | DWJGOPAWKXUUNR-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|