C18H28N2O3 — CID 154670610
N-(2,6-dioxopiperidin-3-yl)-N-[(2-methylphenyl)methyl]formamide;ethane (PubChem CID 154670610) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-N-[(2-methylphenyl)methyl]formamide;ethane.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-N-[(2-methylphenyl)methyl]formamide;ethane |
|---|---|
| PubChem CID | 154670610 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-N-[(2-methylphenyl)methyl]formamide;ethane |
| SMILES | CC.CC.Cc1ccccc1CN(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H16N2O3.2C2H6/c1-10-4-2-3-5-11(10)8-16(9-17)12-6-7-13(18)15-14(12)19;2*1-2/h2-5,9,12H,6-8H2,1H3,(H,15,18,19);2*1-2H3 |
| InChIKey | FTJKKGDFFYGUNL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|