C17H22N2O4 — CID 163374446
N-(2,6-dioxopiperidin-3-yl)-N-formyl-2,3-dimethylbenzamide;ethane (PubChem CID 163374446) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-N-formyl-2,3-dimethylbenzamide;ethane.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-N-formyl-2,3-dimethylbenzamide;ethane |
|---|---|
| PubChem CID | 163374446 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-N-formyl-2,3-dimethylbenzamide;ethane |
| SMILES | CC.Cc1cccc(C(=O)N(C=O)C2CCC(=O)NC2=O)c1C |
| InChI | InChI=1S/C15H16N2O4.C2H6/c1-9-4-3-5-11(10(9)2)15(21)17(8-18)12-6-7-13(19)16-14(12)20;1-2/h3-5,8,12H,6-7H2,1-2H3,(H,16,19,20);1-2H3 |
| InChIKey | AAQOCDPLKROQNU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|