C27H29F3N4O5S — CID 130312159
N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methyl-3-[[4-[[4-(trifluoromethylsulfanyl)piperazin-1-yl]methyl]phenyl]methoxy]benzamide (PubChem CID 130312159) has the molecular formula C27H29F3N4O5S and a molecular weight of 578.61 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methyl-3-[[4-[[4-(trifluoromethylsulfanyl)piperazin-1-yl]methyl]phenyl]methoxy]benzamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methyl-3-[[4-[[4-(trifluoromethylsulfanyl)piperazin-1-yl]methyl]phenyl]methoxy]benzamide |
|---|---|
| PubChem CID | 130312159 |
| Molecular Formula | C27H29F3N4O5S |
| Molecular Weight | 578.61 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methyl-3-[[4-[[4-(trifluoromethylsulfanyl)piperazin-1-yl]methyl]phenyl]methoxy]benzamide |
| SMILES | Cc1c(OCc2ccc(CN3CCN(SC(F)(F)F)CC3)cc2)cccc1C(=O)N(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C27H29F3N4O5S/c1-18-21(26(38)34(17-35)22-9-10-24(36)31-25(22)37)3-2-4-23(18)39-16-20-7-5-19(6-8-20)15-32-11-13-33(14-12-32)40-27(28,29)30/h2-8,17,22H,9-16H2,1H3,(H,31,36,37) |
| InChIKey | DQYUPMBKNYWGMF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|