C26H38N4O7 — CID 163267654
tert-butyl 4-[3-[(2,6-dioxopiperidin-3-yl)-formylcarbamoyl]-5-methoxy-4-methylphenyl]piperazine-1-carboxylate;ethane (PubChem CID 163267654) has the molecular formula C26H38N4O7 and a molecular weight of 518.61 g/mol. Its IUPAC name is tert-butyl 4-[3-[(2,6-dioxopiperidin-3-yl)-formylcarbamoyl]-5-methoxy-4-methylphenyl]piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[3-[(2,6-dioxopiperidin-3-yl)-formylcarbamoyl]-5-methoxy-4-methylphenyl]piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 163267654 |
| Molecular Formula | C26H38N4O7 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | tert-butyl 4-[3-[(2,6-dioxopiperidin-3-yl)-formylcarbamoyl]-5-methoxy-4-methylphenyl]piperazine-1-carboxylate;ethane |
| SMILES | CC.COc1cc(N2CCN(C(=O)OC(C)(C)C)CC2)cc(C(=O)N(C=O)C2CCC(=O)NC2=O)c1C |
| InChI | InChI=1S/C24H32N4O7.C2H6/c1-15-17(22(32)28(14-29)18-6-7-20(30)25-21(18)31)12-16(13-19(15)34-5)26-8-10-27(11-9-26)23(33)35-24(2,3)4;1-2/h12-14,18H,6-11H2,1-5H3,(H,25,30,31);1-2H3 |
| InChIKey | FLAORKGWZZVXDA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|