C24H34N4O6 — CID 178099863
tert-butyl 4-(3,4-diformylphenyl)piperazine-1-carboxylate;3-(dimethylamino)piperidine-2,6-dione (PubChem CID 178099863) has the molecular formula C24H34N4O6 and a molecular weight of 474.56 g/mol. Its IUPAC name is tert-butyl 4-(3,4-diformylphenyl)piperazine-1-carboxylate;3-(dimethylamino)piperidine-2,6-dione.
| Compound Name | tert-butyl 4-(3,4-diformylphenyl)piperazine-1-carboxylate;3-(dimethylamino)piperidine-2,6-dione |
|---|---|
| PubChem CID | 178099863 |
| Molecular Formula | C24H34N4O6 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | tert-butyl 4-(3,4-diformylphenyl)piperazine-1-carboxylate;3-(dimethylamino)piperidine-2,6-dione |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C=O)c(C=O)c2)CC1.CN(C)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C17H22N2O4.C7H12N2O2/c1-17(2,3)23-16(22)19-8-6-18(7-9-19)15-5-4-13(11-20)14(10-15)12-21;1-9(2)5-3-4-6(10)8-7(5)11/h4-5,10-12H,6-9H2,1-3H3;5H,3-4H2,1-2H3,(H,8,10,11) |
| InChIKey | VFITXKNOSAIGDA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|