C30H42N4O6 — CID 172590476
tert-butyl 4-[4-[3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-4-formylphenyl]piperidine-1-carbonyl]piperidine-1-carboxylate (PubChem CID 172590476) has the molecular formula C30H42N4O6 and a molecular weight of 554.69 g/mol. Its IUPAC name is tert-butyl 4-[4-[3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-4-formylphenyl]piperidine-1-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-4-formylphenyl]piperidine-1-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172590476 |
| Molecular Formula | C30H42N4O6 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | tert-butyl 4-[4-[3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-4-formylphenyl]piperidine-1-carbonyl]piperidine-1-carboxylate |
| SMILES | CN(Cc1cc(C2CCN(C(=O)C3CCN(C(=O)OC(C)(C)C)CC3)CC2)ccc1C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C30H42N4O6/c1-30(2,3)40-29(39)34-15-11-21(12-16-34)28(38)33-13-9-20(10-14-33)22-5-6-23(19-35)24(17-22)18-32(4)25-7-8-26(36)31-27(25)37/h5-6,17,19-21,25H,7-16,18H2,1-4H3,(H,31,36,37) |
| InChIKey | ZIGAAQLWZICBKI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|