C24H34N2O8 — CID 167469905
3-[2-[2-[3-[3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-4-formylphenyl]propoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 167469905) has the molecular formula C24H34N2O8 and a molecular weight of 478.54 g/mol. Its IUPAC name is 3-[2-[2-[3-[3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-4-formylphenyl]propoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[3-[3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-4-formylphenyl]propoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 167469905 |
| Molecular Formula | C24H34N2O8 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 3-[2-[2-[3-[3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-4-formylphenyl]propoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | CN(Cc1cc(CCCOCCOCCOCCC(=O)O)ccc1C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C24H34N2O8/c1-26(21-6-7-22(28)25-24(21)31)16-20-15-18(4-5-19(20)17-27)3-2-9-32-11-13-34-14-12-33-10-8-23(29)30/h4-5,15,17,21H,2-3,6-14,16H2,1H3,(H,29,30)(H,25,28,31) |
| InChIKey | VPOKDPOYUQRGPV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|