C22H35N3O4 — CID 156860973
N-[2-[(2,6-dioxopiperidin-3-yl)-methylamino]-5-(6-hydroxyhexyl)phenyl]-N-methylformamide;ethane (PubChem CID 156860973) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-[2-[(2,6-dioxopiperidin-3-yl)-methylamino]-5-(6-hydroxyhexyl)phenyl]-N-methylformamide;ethane.
| Compound Name | N-[2-[(2,6-dioxopiperidin-3-yl)-methylamino]-5-(6-hydroxyhexyl)phenyl]-N-methylformamide;ethane |
|---|---|
| PubChem CID | 156860973 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | N-[2-[(2,6-dioxopiperidin-3-yl)-methylamino]-5-(6-hydroxyhexyl)phenyl]-N-methylformamide;ethane |
| SMILES | CC.CN(C=O)c1cc(CCCCCCO)ccc1N(C)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C20H29N3O4.C2H6/c1-22(14-25)18-13-15(7-5-3-4-6-12-24)8-9-16(18)23(2)17-10-11-19(26)21-20(17)27;1-2/h8-9,13-14,17,24H,3-7,10-12H2,1-2H3,(H,21,26,27);1-2H3 |
| InChIKey | QPVVYZMQFZIYEF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|