C21H35N3O4 — CID 176968223
3-[4-(2-aminoethoxy)-N,2-dimethylanilino]piperidine-2,6-dione;butanal;ethane (PubChem CID 176968223) has the molecular formula C21H35N3O4 and a molecular weight of 393.53 g/mol. Its IUPAC name is 3-[4-(2-aminoethoxy)-N,2-dimethylanilino]piperidine-2,6-dione;butanal;ethane.
| Compound Name | 3-[4-(2-aminoethoxy)-N,2-dimethylanilino]piperidine-2,6-dione;butanal;ethane |
|---|---|
| PubChem CID | 176968223 |
| Molecular Formula | C21H35N3O4 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | 3-[4-(2-aminoethoxy)-N,2-dimethylanilino]piperidine-2,6-dione;butanal;ethane |
| SMILES | CC.CCCC=O.Cc1cc(OCCN)ccc1N(C)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C15H21N3O3.C4H8O.C2H6/c1-10-9-11(21-8-7-16)3-4-12(10)18(2)13-5-6-14(19)17-15(13)20;1-2-3-4-5;1-2/h3-4,9,13H,5-8,16H2,1-2H3,(H,17,19,20);4H,2-3H2,1H3;1-2H3 |
| InChIKey | KGAKUBNIQSBIBL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|